C9H4Cl2F6O — CID 11001479
1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)benzene (PubChem CID 11001479) has the molecular formula C9H4Cl2F6O and a molecular weight of 313.02 g/mol. Its IUPAC name is 1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)benzene.
| Compound Name | 1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)benzene |
|---|---|
| PubChem CID | 11001479 |
| Molecular Formula | C9H4Cl2F6O |
| Molecular Weight | 313.02 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)benzene |
| SMILES | FC(C(F)(F)F)C(F)(F)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H4Cl2F6O/c10-4-1-2-5(11)6(3-4)18-9(16,17)7(12)8(13,14)15/h1-3,7H |
| InChIKey | YNXYLOSBSOCELW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.02 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |