C17H14O6 — CID 11001527
3-(3,4-dihydroxyphenyl)-5,6-dihydroxy-3,4-dihydronaphthalene-2-carboxylic acid (PubChem CID 11001527) has the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-5,6-dihydroxy-3,4-dihydronaphthalene-2-carboxylic acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)-5,6-dihydroxy-3,4-dihydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 11001527 |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-5,6-dihydroxy-3,4-dihydronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)C1=Cc2ccc(O)c(O)c2CC1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H14O6/c18-13-3-1-9(6-15(13)20)10-7-11-8(5-12(10)17(22)23)2-4-14(19)16(11)21/h1-6,10,18-21H,7H2,(H,22,23) |
| InChIKey | CUSSQIRZLCCITR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|