C15H20F3N3O2 — CID 110015961
(2-hydroxycyclopentyl)-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]methanone (PubChem CID 110015961) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is (2-hydroxycyclopentyl)-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]methanone.
| Compound Name | (2-hydroxycyclopentyl)-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110015961 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (2-hydroxycyclopentyl)-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CCCC1O)N1CCC(c2ncc(C(F)(F)F)[nH]2)CC1 |
| InChI | InChI=1S/C15H20F3N3O2/c16-15(17,18)12-8-19-13(20-12)9-4-6-21(7-5-9)14(23)10-2-1-3-11(10)22/h8-11,22H,1-7H2,(H,19,20) |
| InChIKey | SAUXZCZTYSPOEA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |