C15H23N3O4 — CID 110016320
2-amino-N-(2,2-diethyl-4-hydroxybutyl)-6-nitrobenzamide (PubChem CID 110016320) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-amino-N-(2,2-diethyl-4-hydroxybutyl)-6-nitrobenzamide.
| Compound Name | 2-amino-N-(2,2-diethyl-4-hydroxybutyl)-6-nitrobenzamide |
|---|---|
| PubChem CID | 110016320 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-amino-N-(2,2-diethyl-4-hydroxybutyl)-6-nitrobenzamide |
| SMILES | CCC(CC)(CCO)CNC(=O)c1c(N)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N3O4/c1-3-15(4-2,8-9-19)10-17-14(20)13-11(16)6-5-7-12(13)18(21)22/h5-7,19H,3-4,8-10,16H2,1-2H3,(H,17,20) |
| InChIKey | FTYFNDHUUFSGRU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|