C14H15ClN4O2 — CID 110016655
N-[1-(3-chloro-2-pyridinyl)pyrazol-3-yl]-2-hydroxycyclopentane-1-carboxamide (PubChem CID 110016655) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is N-[1-(3-chloro-2-pyridinyl)pyrazol-3-yl]-2-hydroxycyclopentane-1-carboxamide.
| Compound Name | N-[1-(3-chloro-2-pyridinyl)pyrazol-3-yl]-2-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 110016655 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-[1-(3-chloro-2-pyridinyl)pyrazol-3-yl]-2-hydroxycyclopentane-1-carboxamide |
| SMILES | O=C(Nc1ccn(-c2ncccc2Cl)n1)C1CCCC1O |
| InChI | InChI=1S/C14H15ClN4O2/c15-10-4-2-7-16-13(10)19-8-6-12(18-19)17-14(21)9-3-1-5-11(9)20/h2,4,6-9,11,20H,1,3,5H2,(H,17,18,21) |
| InChIKey | GMBWFZLHIYWQBG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |