C16H18Cl2N2O — CID 110017074
1-(2,4-dichlorophenyl)-2-[methyl(2-pyridin-4-ylethyl)amino]ethanol (PubChem CID 110017074) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-[methyl(2-pyridin-4-ylethyl)amino]ethanol.
| Compound Name | 1-(2,4-dichlorophenyl)-2-[methyl(2-pyridin-4-ylethyl)amino]ethanol |
|---|---|
| PubChem CID | 110017074 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-[methyl(2-pyridin-4-ylethyl)amino]ethanol |
| SMILES | CN(CCc1ccncc1)CC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O/c1-20(9-6-12-4-7-19-8-5-12)11-16(21)14-3-2-13(17)10-15(14)18/h2-5,7-8,10,16,21H,6,9,11H2,1H3 |
| InChIKey | HJTVNQGEPQAUSR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |