About methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate
methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate (PubChem CID 110018061) has the molecular formula C22H28N4O2
and a molecular weight of 380.49 g/mol. Its IUPAC name is methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate |
| PubChem CID | 110018061 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/Cc1ccc(C(=O)OC)c(C2CC2)n1 |
| InChI | InChI=1S/C22H28N4O2/c1-4-14-7-6-8-15(5-2)19(14)26-22(23)24-13-17-11-12-18(21(27)28-3)20(25-17)16-9-10-16/h6-8,11-12,16H,4-5,9-10,13H2,1-3H3,(H3,23,24,26) |
| InChIKey | ICUJWIKCMRDZDF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate?
The IUPAC name of methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate (CID 110018061) is methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate.
What is the SMILES notation for methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate?
The canonical SMILES for methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate is CCc1cccc(CC)c1N/C(N)=N/Cc1ccc(C(=O)OC)c(C2CC2)n1.
What is the InChIKey of methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate?
The InChIKey is ICUJWIKCMRDZDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N4O2/c1-4-14-7-6-8-15(5-2)19(14)26-22(23)24-13-17-11-12-18(21(27)28-3)20(25-17)16-9-10-16/h6-8,11-12,16H,4-5,9-10,13H2,1-3H3,(H3,23,24,26).
What are the key properties of methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate?
methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate has a molecular weight of 380.49 g/mol, XLogP of 3.80, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate is sourced from PubChem (CID 110018061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).