C20H22FN3 — CID 11001834
N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 11001834) has the molecular formula C20H22FN3 and a molecular weight of 323.42 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 11001834 |
| Molecular Formula | C20H22FN3 |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-[2-(4-fluorophenyl)quinolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C20H22FN3/c1-24(2)13-5-12-22-20-14-19(15-8-10-16(21)11-9-15)23-18-7-4-3-6-17(18)20/h3-4,6-11,14H,5,12-13H2,1-2H3,(H,22,23) |
| InChIKey | LINMBGNVVIFRTF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|