C14H22N4O3 — CID 110018843
2-[(3-methyl-4-nitropyrazol-1-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 110018843) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[(3-methyl-4-nitropyrazol-1-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[(3-methyl-4-nitropyrazol-1-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 110018843 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[(3-methyl-4-nitropyrazol-1-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | Cc1nn(CN2CCC3(O)CCCCC3C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H22N4O3/c1-11-13(18(20)21)9-17(15-11)10-16-7-6-14(19)5-3-2-4-12(14)8-16/h9,12,19H,2-8,10H2,1H3 |
| InChIKey | OBNKHCKHNBZXPY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|