C18H32O3Si — CID 11001886
[(4R,4'aS,5R,8'aR)-4,4'a,5-trimethylspiro[1,3-dioxolane-2,5'-1,4,6,7,8,8a-hexahydronaphthalene]-2'-yl]oxy-trimethylsilane (PubChem CID 11001886) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is [(4R,4'aS,5R,8'aR)-4,4'a,5-trimethylspiro[1,3-dioxolane-2,5'-1,4,6,7,8,8a-hexahydronaphthalene]-2'-yl]oxy-trimethylsilane.
| Compound Name | [(4R,4'aS,5R,8'aR)-4,4'a,5-trimethylspiro[1,3-dioxolane-2,5'-1,4,6,7,8,8a-hexahydronaphthalene]-2'-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11001886 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | [(4R,4'aS,5R,8'aR)-4,4'a,5-trimethylspiro[1,3-dioxolane-2,5'-1,4,6,7,8,8a-hexahydronaphthalene]-2'-yl]oxy-trimethylsilane |
| SMILES | C[C@H]1OC2(CCC[C@@H]3CC(O[Si](C)(C)C)=CC[C@@]32C)O[C@@H]1C |
| InChI | InChI=1S/C18H32O3Si/c1-13-14(2)20-18(19-13)10-7-8-15-12-16(21-22(4,5)6)9-11-17(15,18)3/h9,13-15H,7-8,10-12H2,1-6H3/t13-,14-,15-,17+/m1/s1 |
| InChIKey | OTLJQKQEAFGQTO-ANQUJSFKSA-N |
| XLogP | 4.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|