About diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate
diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate (PubChem CID 11001929) has the molecular formula C17H26O6
and a molecular weight of 326.39 g/mol. Its IUPAC name is diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate |
| PubChem CID | 11001929 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate |
| SMILES | C=C[C@@H]1CCC2(OCCO2)[C@H]1CC(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C17H26O6/c1-4-12-7-8-17(22-9-10-23-17)14(12)11-13(15(18)20-5-2)16(19)21-6-3/h4,12-14H,1,5-11H2,2-3H3/t12-,14+/m1/s1 |
| InChIKey | ADBWARZWHGHPES-OCCSQVGLSA-N |
| XLogP | 2.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate?
The IUPAC name of diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate (CID 11001929) is diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate.
What is the SMILES notation for diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate?
The canonical SMILES for diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate is C=C[C@@H]1CCC2(OCCO2)[C@H]1CC(C(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate?
The InChIKey is ADBWARZWHGHPES-OCCSQVGLSA-N. The full InChI is InChI=1S/C17H26O6/c1-4-12-7-8-17(22-9-10-23-17)14(12)11-13(15(18)20-5-2)16(19)21-6-3/h4,12-14H,1,5-11H2,2-3H3/t12-,14+/m1/s1.
What are the key properties of diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate?
diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate has a molecular weight of 326.39 g/mol, XLogP of 2.07, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[[(8S,9S)-8-ethenyl-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]propanedioate is sourced from PubChem (CID 11001929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).