C18H22S2Si — CID 11002051
[(Z)-1,3-bis(phenylsulfanyl)prop-1-enyl]-trimethylsilane (PubChem CID 11002051) has the molecular formula C18H22S2Si and a molecular weight of 330.59 g/mol. Its IUPAC name is [(Z)-1,3-bis(phenylsulfanyl)prop-1-enyl]-trimethylsilane.
| Compound Name | [(Z)-1,3-bis(phenylsulfanyl)prop-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11002051 |
| Molecular Formula | C18H22S2Si |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | [(Z)-1,3-bis(phenylsulfanyl)prop-1-enyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C(=C/CSc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C18H22S2Si/c1-21(2,3)18(20-17-12-8-5-9-13-17)14-15-19-16-10-6-4-7-11-16/h4-14H,15H2,1-3H3/b18-14+ |
| InChIKey | IYMACSDNXZHUQI-NBVRZTHBSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|