C16H22F3NO3 — CID 11002115
tert-butyl N-[(2S)-4,4,4-trifluoro-1-phenylmethoxybutan-2-yl]carbamate (PubChem CID 11002115) has the molecular formula C16H22F3NO3 and a molecular weight of 333.35 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4,4,4-trifluoro-1-phenylmethoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4,4,4-trifluoro-1-phenylmethoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 11002115 |
| Molecular Formula | C16H22F3NO3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | tert-butyl N-[(2S)-4,4,4-trifluoro-1-phenylmethoxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](COCc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C16H22F3NO3/c1-15(2,3)23-14(21)20-13(9-16(17,18)19)11-22-10-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | JOEXNYZARLYUMY-ZDUSSCGKSA-N |
| XLogP | 4.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |