C13H23NO2 — CID 110021356
N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2,3-dimethylpentanamide (PubChem CID 110021356) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2,3-dimethylpentanamide.
| Compound Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2,3-dimethylpentanamide |
|---|---|
| PubChem CID | 110021356 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2,3-dimethylpentanamide |
| SMILES | CCC(C)C(C)C(=O)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C13H23NO2/c1-4-9(2)10(3)13(16)14-12-6-5-11(7-12)8-15/h5-6,9-12,15H,4,7-8H2,1-3H3,(H,14,16)/t9?,10?,11-,12+/m0/s1 |
| InChIKey | JPNDTIXIJMFHBO-MMVSWEMESA-N |
| XLogP | 1.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|