C20H30O4 — CID 11002152
11-O-tert-butyl 1-O-methyl (2E,6E,8E,10E)-10-ethylidene-2,8-dimethylundeca-2,6,8-trienedioate (PubChem CID 11002152) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 11-O-tert-butyl 1-O-methyl (2E,6E,8E,10E)-10-ethylidene-2,8-dimethylundeca-2,6,8-trienedioate.
| Compound Name | 11-O-tert-butyl 1-O-methyl (2E,6E,8E,10E)-10-ethylidene-2,8-dimethylundeca-2,6,8-trienedioate |
|---|---|
| PubChem CID | 11002152 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 11-O-tert-butyl 1-O-methyl (2E,6E,8E,10E)-10-ethylidene-2,8-dimethylundeca-2,6,8-trienedioate |
| SMILES | C/C=C(\C=C(C)\C=C\CC/C=C(\C)C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30O4/c1-8-17(19(22)24-20(4,5)6)14-15(2)12-10-9-11-13-16(3)18(21)23-7/h8,10,12-14H,9,11H2,1-7H3/b12-10+,15-14+,16-13+,17-8+ |
| InChIKey | QZPXYTSCYWDTMU-TUFAIYLKSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|