C20H38O2Si — CID 11002260
[(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 11002260) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is [(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11002260 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | [(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C/C=C1\CO[C@H]2CCC(C)(C)[C@H](CO[Si](C)(C)C(C)(C)C)[C@@]12C |
| InChI | InChI=1S/C20H38O2Si/c1-10-15-13-21-17-11-12-19(5,6)16(20(15,17)7)14-22-23(8,9)18(2,3)4/h10,16-17H,11-14H2,1-9H3/b15-10+/t16-,17-,20+/m0/s1 |
| InChIKey | IVIUUKYRMJFCHC-LODJZIJNSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|