C9H15Cl2NO2 — CID 110022839
2,2-dichloro-1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 110022839) has the molecular formula C9H15Cl2NO2 and a molecular weight of 240.13 g/mol. Its IUPAC name is 2,2-dichloro-1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 2,2-dichloro-1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 110022839 |
| Molecular Formula | C9H15Cl2NO2 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 2,2-dichloro-1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CC(O)C1CCN(C(=O)C(C)(Cl)Cl)C1 |
| InChI | InChI=1S/C9H15Cl2NO2/c1-6(13)7-3-4-12(5-7)8(14)9(2,10)11/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | GBEAXRKXEBLLPY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|