C17H18ClNO3 — CID 110023322
(4-chloro-1-hydroxynaphthalen-2-yl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone (PubChem CID 110023322) has the molecular formula C17H18ClNO3 and a molecular weight of 319.79 g/mol. Its IUPAC name is (4-chloro-1-hydroxynaphthalen-2-yl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-chloro-1-hydroxynaphthalen-2-yl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 110023322 |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (4-chloro-1-hydroxynaphthalen-2-yl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone |
| SMILES | CC(O)C1CCN(C(=O)c2cc(Cl)c3ccccc3c2O)C1 |
| InChI | InChI=1S/C17H18ClNO3/c1-10(20)11-6-7-19(9-11)17(22)14-8-15(18)12-4-2-3-5-13(12)16(14)21/h2-5,8,10-11,20-21H,6-7,9H2,1H3 |
| InChIKey | XGRLVQOUPQUYIV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |