C18H19ClN2O3 — CID 110023340
(3-chloro-4-pyridin-4-yloxyphenyl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone (PubChem CID 110023340) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is (3-chloro-4-pyridin-4-yloxyphenyl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-chloro-4-pyridin-4-yloxyphenyl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 110023340 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (3-chloro-4-pyridin-4-yloxyphenyl)-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone |
| SMILES | CC(O)C1CCN(C(=O)c2ccc(Oc3ccncc3)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-12(22)14-6-9-21(11-14)18(23)13-2-3-17(16(19)10-13)24-15-4-7-20-8-5-15/h2-5,7-8,10,12,14,22H,6,9,11H2,1H3 |
| InChIKey | XRQGMZHFKXRLFJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |