C15H20FNO2S — CID 110023458
[4-fluoro-3-(methylsulfanylmethyl)phenyl]-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone (PubChem CID 110023458) has the molecular formula C15H20FNO2S and a molecular weight of 297.40 g/mol. Its IUPAC name is [4-fluoro-3-(methylsulfanylmethyl)phenyl]-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [4-fluoro-3-(methylsulfanylmethyl)phenyl]-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 110023458 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [4-fluoro-3-(methylsulfanylmethyl)phenyl]-[3-(1-hydroxyethyl)pyrrolidin-1-yl]methanone |
| SMILES | CSCc1cc(C(=O)N2CCC(C(C)O)C2)ccc1F |
| InChI | InChI=1S/C15H20FNO2S/c1-10(18)12-5-6-17(8-12)15(19)11-3-4-14(16)13(7-11)9-20-2/h3-4,7,10,12,18H,5-6,8-9H2,1-2H3 |
| InChIKey | USEPEXJWTRCHGJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |