C21H29NO3 — CID 11002426
methyl (1S,3aS,4S,5S,7aS)-4-(cyanomethyl)-7a-methyl-5-[(1R)-1-methyl-2-oxocyclohex-3-en-1-yl]-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate (PubChem CID 11002426) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is methyl (1S,3aS,4S,5S,7aS)-4-(cyanomethyl)-7a-methyl-5-[(1R)-1-methyl-2-oxocyclohex-3-en-1-yl]-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate.
| Compound Name | methyl (1S,3aS,4S,5S,7aS)-4-(cyanomethyl)-7a-methyl-5-[(1R)-1-methyl-2-oxocyclohex-3-en-1-yl]-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate |
|---|---|
| PubChem CID | 11002426 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | methyl (1S,3aS,4S,5S,7aS)-4-(cyanomethyl)-7a-methyl-5-[(1R)-1-methyl-2-oxocyclohex-3-en-1-yl]-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC[C@H]2[C@H](CC#N)[C@@H]([C@@]3(C)CCC=CC3=O)CC[C@]12C |
| InChI | InChI=1S/C21H29NO3/c1-20-12-9-16(21(2)11-5-4-6-18(21)23)14(10-13-22)15(20)7-8-17(20)19(24)25-3/h4,6,14-17H,5,7-12H2,1-3H3/t14-,15-,16-,17+,20-,21+/m0/s1 |
| InChIKey | PFVVLDSMDFMHQX-XYNCURNNSA-N |
| XLogP | 4.06 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |