About 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide
3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide (PubChem CID 110025160) has the molecular formula C14H16N2O2S
and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide.
Molecular Properties
| Compound Name | 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide |
| PubChem CID | 110025160 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide |
| SMILES | Cn1ccs/c1=N\C(=O)CC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C14H16N2O2S/c1-14(18,11-6-4-3-5-7-11)10-12(17)15-13-16(2)8-9-19-13/h3-9,18H,10H2,1-2H3/b15-13- |
| InChIKey | KJSSCWMFOZMDQM-SQFISAMPSA-N |
| XLogP | 1.81 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide?
The IUPAC name of 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide (CID 110025160) is 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide.
What is the SMILES notation for 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide?
The canonical SMILES for 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide is Cn1ccs/c1=N\C(=O)CC(C)(O)c1ccccc1.
What is the InChIKey of 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide?
The InChIKey is KJSSCWMFOZMDQM-SQFISAMPSA-N. The full InChI is InChI=1S/C14H16N2O2S/c1-14(18,11-6-4-3-5-7-11)10-12(17)15-13-16(2)8-9-19-13/h3-9,18H,10H2,1-2H3/b15-13-.
What are the key properties of 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide?
3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide has a molecular weight of 276.36 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylbutanamide is sourced from PubChem (CID 110025160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).