C19H25NO5 — CID 11002528
(1R,2R,4R,8R,9S,12R)-14-benzyl-6,6-dimethyl-3,5,7,13-tetraoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecan-9-ol (PubChem CID 11002528) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is (1R,2R,4R,8R,9S,12R)-14-benzyl-6,6-dimethyl-3,5,7,13-tetraoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecan-9-ol.
| Compound Name | (1R,2R,4R,8R,9S,12R)-14-benzyl-6,6-dimethyl-3,5,7,13-tetraoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecan-9-ol |
|---|---|
| PubChem CID | 11002528 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (1R,2R,4R,8R,9S,12R)-14-benzyl-6,6-dimethyl-3,5,7,13-tetraoxa-14-azatetracyclo[10.2.1.02,9.04,8]pentadecan-9-ol |
| SMILES | CC1(C)O[C@H]2O[C@@H]3[C@H]4C[C@@H](CC[C@@]3(O)[C@H]2O1)ON4Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO5/c1-18(2)23-16-17(24-18)22-15-14-10-13(8-9-19(15,16)21)25-20(14)11-12-6-4-3-5-7-12/h3-7,13-17,21H,8-11H2,1-2H3/t13-,14-,15-,16+,17-,19+/m1/s1 |
| InChIKey | RELPVQDBJNEKGK-AKOCFDCFSA-N |
| XLogP | 1.96 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |