C23H25NO2 — CID 11002535
(2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-10-yl)methanol (PubChem CID 11002535) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-10-yl)methanol.
| Compound Name | (2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-10-yl)methanol |
|---|---|
| PubChem CID | 11002535 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-10-yl)methanol |
| SMILES | C=CCC1Oc2cccc(CO)c2-c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C23H25NO2/c1-5-7-18-22-16(21-15(13-25)8-6-9-19(21)26-18)10-11-17-20(22)14(2)12-23(3,4)24-17/h5-6,8-12,18,24-25H,1,7,13H2,2-4H3 |
| InChIKey | CRODFMXMGHZTCT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|