About 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene
1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene (PubChem CID 11002559) has the molecular formula C22H20O2S
and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene |
| PubChem CID | 11002559 |
| Molecular Formula | C22H20O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H](/C=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20O2S/c1-18-12-15-21(16-13-18)25(23,24)22(20-10-6-3-7-11-20)17-14-19-8-4-2-5-9-19/h2-17,22H,1H3/b17-14+/t22-/m0/s1 |
| InChIKey | AQZHDBHVKNISCQ-QMPJNXRZSA-N |
| XLogP | 5.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene?
The IUPAC name of 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene (CID 11002559) is 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene.
What is the SMILES notation for 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene?
The canonical SMILES for 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene is Cc1ccc(S(=O)(=O)[C@@H](/C=C/c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene?
The InChIKey is AQZHDBHVKNISCQ-QMPJNXRZSA-N. The full InChI is InChI=1S/C22H20O2S/c1-18-12-15-21(16-13-18)25(23,24)22(20-10-6-3-7-11-20)17-14-19-8-4-2-5-9-19/h2-17,22H,1H3/b17-14+/t22-/m0/s1.
What are the key properties of 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene?
1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene has a molecular weight of 348.47 g/mol, XLogP of 5.22, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E,1S)-1,3-diphenylprop-2-enyl]sulfonyl-4-methylbenzene is sourced from PubChem (CID 11002559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).