C16H15Cl2NO3 — CID 110026377
N-(3,5-dichloro-4-hydroxyphenyl)-3-hydroxy-3-phenylbutanamide (PubChem CID 110026377) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-3-hydroxy-3-phenylbutanamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-3-hydroxy-3-phenylbutanamide |
|---|---|
| PubChem CID | 110026377 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-3-hydroxy-3-phenylbutanamide |
| SMILES | CC(O)(CC(=O)Nc1cc(Cl)c(O)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C16H15Cl2NO3/c1-16(22,10-5-3-2-4-6-10)9-14(20)19-11-7-12(17)15(21)13(18)8-11/h2-8,21-22H,9H2,1H3,(H,19,20) |
| InChIKey | BVUXVZVONRODLW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|