C20H18O6 — CID 11002708
(3S,4S)-3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-one (PubChem CID 11002708) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is (3S,4S)-3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-one.
| Compound Name | (3S,4S)-3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-one |
|---|---|
| PubChem CID | 11002708 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (3S,4S)-3,4-bis(1,3-benzodioxol-5-ylmethyl)oxolan-2-one |
| SMILES | O=C1OC[C@@H](Cc2ccc3c(c2)OCO3)[C@@H]1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H18O6/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16/h1-4,7-8,14-15H,5-6,9-11H2/t14-,15+/m1/s1 |
| InChIKey | DDWGQGZPYDSYEL-CABCVRRESA-N |
| XLogP | 2.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |