C24H33N3O3 — CID 110027131
1-(2,5-diethoxyphenyl)-2-[2-(oxan-4-yl)-1-phenylethyl]guanidine (PubChem CID 110027131) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-[2-(oxan-4-yl)-1-phenylethyl]guanidine.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-[2-(oxan-4-yl)-1-phenylethyl]guanidine |
|---|---|
| PubChem CID | 110027131 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-[2-(oxan-4-yl)-1-phenylethyl]guanidine |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/C(CC2CCOCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H33N3O3/c1-3-29-20-10-11-23(30-4-2)22(17-20)27-24(25)26-21(19-8-6-5-7-9-19)16-18-12-14-28-15-13-18/h5-11,17-18,21H,3-4,12-16H2,1-2H3,(H3,25,26,27) |
| InChIKey | VYOYBQGRSVKPMC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|