C17H24N2O3 — CID 110028029
N-[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]-3-(5-methoxy-3-pyridinyl)propanamide (PubChem CID 110028029) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]-3-(5-methoxy-3-pyridinyl)propanamide.
| Compound Name | N-[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]-3-(5-methoxy-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 110028029 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]-3-(5-methoxy-3-pyridinyl)propanamide |
| SMILES | COc1cncc(CCC(=O)NC2C3CCC(C3)C2CO)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-22-14-6-11(8-18-9-14)2-5-16(21)19-17-13-4-3-12(7-13)15(17)10-20/h6,8-9,12-13,15,17,20H,2-5,7,10H2,1H3,(H,19,21) |
| InChIKey | XCIZVSGQMXDUAR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |