C16H25ClN2O2 — CID 110028174
2-chloro-N-(3-hydroxy-2,2,4-trimethylpentyl)-4,6-dimethylpyridine-3-carboxamide (PubChem CID 110028174) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 2-chloro-N-(3-hydroxy-2,2,4-trimethylpentyl)-4,6-dimethylpyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(3-hydroxy-2,2,4-trimethylpentyl)-4,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 110028174 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-chloro-N-(3-hydroxy-2,2,4-trimethylpentyl)-4,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(C(=O)NCC(C)(C)C(O)C(C)C)c(Cl)n1 |
| InChI | InChI=1S/C16H25ClN2O2/c1-9(2)13(20)16(5,6)8-18-15(21)12-10(3)7-11(4)19-14(12)17/h7,9,13,20H,8H2,1-6H3,(H,18,21) |
| InChIKey | DTYSNJQKHHMXJD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|