C20H20ClNO3 — CID 11002840
N-[2-[2-[(3-chlorophenyl)methyl]-5-methoxy-1-benzofuran-3-yl]ethyl]acetamide (PubChem CID 11002840) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is N-[2-[2-[(3-chlorophenyl)methyl]-5-methoxy-1-benzofuran-3-yl]ethyl]acetamide.
| Compound Name | N-[2-[2-[(3-chlorophenyl)methyl]-5-methoxy-1-benzofuran-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 11002840 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[2-[2-[(3-chlorophenyl)methyl]-5-methoxy-1-benzofuran-3-yl]ethyl]acetamide |
| SMILES | COc1ccc2oc(Cc3cccc(Cl)c3)c(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C20H20ClNO3/c1-13(23)22-9-8-17-18-12-16(24-2)6-7-19(18)25-20(17)11-14-4-3-5-15(21)10-14/h3-7,10,12H,8-9,11H2,1-2H3,(H,22,23) |
| InChIKey | ZIYGGMCXBZJOAI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |