About 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol
2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol (PubChem CID 110028536) has the molecular formula C14H20N4O
and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol.
Molecular Properties
| Compound Name | 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol |
| PubChem CID | 110028536 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol |
| SMILES | Cc1cc(C)cc(-n2ncc(CNC(C)CO)n2)c1 |
| InChI | InChI=1S/C14H20N4O/c1-10-4-11(2)6-14(5-10)18-16-8-13(17-18)7-15-12(3)9-19/h4-6,8,12,15,19H,7,9H2,1-3H3 |
| InChIKey | ACGLABRKBBHTSN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol?
The IUPAC name of 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol (CID 110028536) is 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol.
What is the SMILES notation for 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol?
The canonical SMILES for 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol is Cc1cc(C)cc(-n2ncc(CNC(C)CO)n2)c1.
What is the InChIKey of 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol?
The InChIKey is ACGLABRKBBHTSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O/c1-10-4-11(2)6-14(5-10)18-16-8-13(17-18)7-15-12(3)9-19/h4-6,8,12,15,19H,7,9H2,1-3H3.
What are the key properties of 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol?
2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol has a molecular weight of 260.34 g/mol, XLogP of 1.35, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]propan-1-ol is sourced from PubChem (CID 110028536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).