About 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol
4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol (PubChem CID 110028537) has the molecular formula C16H24N4O
and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol |
| PubChem CID | 110028537 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol |
| SMILES | Cc1cc(C)cc(-n2ncc(CNCC(C)CCO)n2)c1 |
| InChI | InChI=1S/C16H24N4O/c1-12(4-5-21)9-17-10-15-11-18-20(19-15)16-7-13(2)6-14(3)8-16/h6-8,11-12,17,21H,4-5,9-10H2,1-3H3 |
| InChIKey | WNGRFWQHONKVEI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol?
The IUPAC name of 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol (CID 110028537) is 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol.
What is the SMILES notation for 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol?
The canonical SMILES for 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol is Cc1cc(C)cc(-n2ncc(CNCC(C)CCO)n2)c1.
What is the InChIKey of 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol?
The InChIKey is WNGRFWQHONKVEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O/c1-12(4-5-21)9-17-10-15-11-18-20(19-15)16-7-13(2)6-14(3)8-16/h6-8,11-12,17,21H,4-5,9-10H2,1-3H3.
What are the key properties of 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol?
4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol has a molecular weight of 288.39 g/mol, XLogP of 1.99, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(3,5-dimethylphenyl)triazol-4-yl]methylamino]-3-methylbutan-1-ol is sourced from PubChem (CID 110028537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).