C9H16F3IN4O — CID 110030387
2-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 110030387) has the molecular formula C9H16F3IN4O and a molecular weight of 380.15 g/mol. Its IUPAC name is 2-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 110030387 |
| Molecular Formula | C9H16F3IN4O |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 2-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | CN(/C(N)=N/CC(=O)NCC(F)(F)F)C1CC1.I |
| InChI | InChI=1S/C9H15F3N4O.HI/c1-16(6-2-3-6)8(13)14-4-7(17)15-5-9(10,11)12;/h6H,2-5H2,1H3,(H2,13,14)(H,15,17);1H |
| InChIKey | IJHAALIJTVPANO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|