About 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide (PubChem CID 110031291) has the molecular formula C13H23IN4O
and a molecular weight of 378.26 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide.
Molecular Properties
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide |
| PubChem CID | 110031291 |
| Molecular Formula | C13H23IN4O |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/Cc1ncc(C(C)(C)C)o1)C1CC1.I |
| InChI | InChI=1S/C13H22N4O.HI/c1-13(2,3)10-7-15-11(18-10)8-16-12(14)17(4)9-5-6-9;/h7,9H,5-6,8H2,1-4H3,(H2,14,16);1H |
| InChIKey | VLBIAWAZVHNURC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide?
The IUPAC name of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide (CID 110031291) is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide.
What is the SMILES notation for 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide?
The canonical SMILES for 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide is CN(/C(N)=N/Cc1ncc(C(C)(C)C)o1)C1CC1.I.
What is the InChIKey of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide?
The InChIKey is VLBIAWAZVHNURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O.HI/c1-13(2,3)10-7-15-11(18-10)8-16-12(14)17(4)9-5-6-9;/h7,9H,5-6,8H2,1-4H3,(H2,14,16);1H.
What are the key properties of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide?
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide has a molecular weight of 378.26 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide is sourced from PubChem (CID 110031291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).