About [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium
[(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium (PubChem CID 11003146) has the molecular formula C7H9ClCrO3
and a molecular weight of 228.59 g/mol. Its IUPAC name is [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium.
Molecular Properties
| Compound Name | [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium |
| PubChem CID | 11003146 |
| Molecular Formula | C7H9ClCrO3 |
| Molecular Weight | 228.59 g/mol |
| Exact Mass | 227.96 |
| IUPAC Name | [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium |
| SMILES | COCOC(=[Cr])C1=C(Cl)CCO1 |
| InChI | InChI=1S/C7H9ClO3.Cr/c1-9-5-10-4-7-6(8)2-3-11-7;/h2-3,5H2,1H3; |
| InChIKey | JIKXUGLFTMPPMS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.59 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium?
The IUPAC name of [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium (CID 11003146) is [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium.
What is the SMILES notation for [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium?
The canonical SMILES for [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium is COCOC(=[Cr])C1=C(Cl)CCO1.
What is the InChIKey of [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium?
The InChIKey is JIKXUGLFTMPPMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClO3.Cr/c1-9-5-10-4-7-6(8)2-3-11-7;/h2-3,5H2,1H3;.
What are the key properties of [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium?
[(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium has a molecular weight of 228.59 g/mol, XLogP of 1.15, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-chloro-2,3-dihydrofuran-5-yl)-(methoxymethoxy)methylidene]chromium is sourced from PubChem (CID 11003146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).