About 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide
2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110033415) has the molecular formula C12H25FN4O
and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide |
| PubChem CID | 110033415 |
| Molecular Formula | C12H25FN4O |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCCCN/C(=N\CC(=O)N(C)C)NCCCF |
| InChI | InChI=1S/C12H25FN4O/c1-4-5-8-14-12(15-9-6-7-13)16-10-11(18)17(2)3/h4-10H2,1-3H3,(H2,14,15,16) |
| InChIKey | XDPFWNJJDOVCJQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide?
The IUPAC name of 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide (CID 110033415) is 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide is CCCCN/C(=N\CC(=O)N(C)C)NCCCF.
What is the InChIKey of 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide?
The InChIKey is XDPFWNJJDOVCJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25FN4O/c1-4-5-8-14-12(15-9-6-7-13)16-10-11(18)17(2)3/h4-10H2,1-3H3,(H2,14,15,16).
What are the key properties of 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide?
2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide has a molecular weight of 260.36 g/mol, XLogP of 0.77, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[butylamino-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide is sourced from PubChem (CID 110033415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).