C20H37F3IN5O2 — CID 110033930
N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110033930) has the molecular formula C20H37F3IN5O2 and a molecular weight of 563.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110033930 |
| Molecular Formula | C20H37F3IN5O2 |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(/NCCC1CCN(CC(F)(F)F)CC1)NCC1CCCCO1.I |
| InChI | InChI=1S/C20H36F3N5O2.HI/c1-27(2)18(29)14-26-19(25-13-17-5-3-4-12-30-17)24-9-6-16-7-10-28(11-8-16)15-20(21,22)23;/h16-17H,3-15H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | XFUBECBPFUODOS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|