C20H36F3N5O2 — CID 110033931
N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide (PubChem CID 110033931) has the molecular formula C20H36F3N5O2 and a molecular weight of 435.54 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110033931 |
| Molecular Formula | C20H36F3N5O2 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(/NCCC1CCN(CC(F)(F)F)CC1)NCC1CCCCO1 |
| InChI | InChI=1S/C20H36F3N5O2/c1-27(2)18(29)14-26-19(25-13-17-5-3-4-12-30-17)24-9-6-16-7-10-28(11-8-16)15-20(21,22)23/h16-17H,3-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | VXYNPKYXCSTZBV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|