C19H39IN4O2 — CID 110034452
2-[[[[1-(2-ethoxyethyl)cyclopentyl]methylamino]-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110034452) has the molecular formula C19H39IN4O2 and a molecular weight of 482.45 g/mol. Its IUPAC name is 2-[[[[1-(2-ethoxyethyl)cyclopentyl]methylamino]-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[[1-(2-ethoxyethyl)cyclopentyl]methylamino]-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110034452 |
| Molecular Formula | C19H39IN4O2 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 2-[[[[1-(2-ethoxyethyl)cyclopentyl]methylamino]-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOCCC1(CN/C(=N/CC(=O)N(C)C)NCC(C)C)CCCC1.I |
| InChI | InChI=1S/C19H38N4O2.HI/c1-6-25-12-11-19(9-7-8-10-19)15-22-18(20-13-16(2)3)21-14-17(24)23(4)5;/h16H,6-15H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | LSGDTJNXBGJFRN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|