C14H22Br2O2 — CID 11003452
(4R,5R)-4-[(2E,5R)-7,7-dibromo-5-methylhepta-2,6-dien-2-yl]-2,2,5-trimethyl-1,3-dioxolane (PubChem CID 11003452) has the molecular formula C14H22Br2O2 and a molecular weight of 382.14 g/mol. Its IUPAC name is (4R,5R)-4-[(2E,5R)-7,7-dibromo-5-methylhepta-2,6-dien-2-yl]-2,2,5-trimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4-[(2E,5R)-7,7-dibromo-5-methylhepta-2,6-dien-2-yl]-2,2,5-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11003452 |
| Molecular Formula | C14H22Br2O2 |
| Molecular Weight | 382.14 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | (4R,5R)-4-[(2E,5R)-7,7-dibromo-5-methylhepta-2,6-dien-2-yl]-2,2,5-trimethyl-1,3-dioxolane |
| SMILES | C/C(=C\C[C@@H](C)C=C(Br)Br)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C14H22Br2O2/c1-9(8-12(15)16)6-7-10(2)13-11(3)17-14(4,5)18-13/h7-9,11,13H,6H2,1-5H3/b10-7+/t9-,11-,13-/m1/s1 |
| InChIKey | GCPWQONTBZQLPK-NXFAFEFLSA-N |
| XLogP | 5.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.14 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|