C16H33IN4O2 — CID 110034804
N,N-dimethyl-2-[[(2-methylpropylamino)-[2-(oxan-2-yl)ethylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110034804) has the molecular formula C16H33IN4O2 and a molecular weight of 440.37 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylpropylamino)-[2-(oxan-2-yl)ethylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-methylpropylamino)-[2-(oxan-2-yl)ethylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110034804 |
| Molecular Formula | C16H33IN4O2 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylpropylamino)-[2-(oxan-2-yl)ethylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(C)CN/C(=N\CC(=O)N(C)C)NCCC1CCCCO1.I |
| InChI | InChI=1S/C16H32N4O2.HI/c1-13(2)11-18-16(19-12-15(21)20(3)4)17-9-8-14-7-5-6-10-22-14;/h13-14H,5-12H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | VBWHZKUHPIRBQP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|