C14H25IO4 — CID 11003520
(Z,4R)-6-iodo-3,5-dimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hex-2-ene-1,5-diol (PubChem CID 11003520) has the molecular formula C14H25IO4 and a molecular weight of 384.25 g/mol. Its IUPAC name is (Z,4R)-6-iodo-3,5-dimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hex-2-ene-1,5-diol.
| Compound Name | (Z,4R)-6-iodo-3,5-dimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hex-2-ene-1,5-diol |
|---|---|
| PubChem CID | 11003520 |
| Molecular Formula | C14H25IO4 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (Z,4R)-6-iodo-3,5-dimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hex-2-ene-1,5-diol |
| SMILES | C/C(=C/CO)[C@@H](CCC1(C)OCCO1)C(C)(O)CI |
| InChI | InChI=1S/C14H25IO4/c1-11(5-7-16)12(13(2,17)10-15)4-6-14(3)18-8-9-19-14/h5,12,16-17H,4,6-10H2,1-3H3/b11-5-/t12-,13?/m1/s1 |
| InChIKey | WRLOQZDCXPPWEG-ZEPRWGSSSA-N |
| XLogP | 2.27 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|