C24H35IN4O2 — CID 110035540
2-[[[[3-(4-methoxyphenyl)-2-methylpropyl]amino]-(1-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110035540) has the molecular formula C24H35IN4O2 and a molecular weight of 538.47 g/mol. Its IUPAC name is 2-[[[[3-(4-methoxyphenyl)-2-methylpropyl]amino]-(1-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[[3-(4-methoxyphenyl)-2-methylpropyl]amino]-(1-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110035540 |
| Molecular Formula | C24H35IN4O2 |
| Molecular Weight | 538.47 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 2-[[[[3-(4-methoxyphenyl)-2-methylpropyl]amino]-(1-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(CC(C)CN/C(=N/CC(=O)N(C)C)NC(C)c2ccccc2)cc1.I |
| InChI | InChI=1S/C24H34N4O2.HI/c1-18(15-20-11-13-22(30-5)14-12-20)16-25-24(26-17-23(29)28(3)4)27-19(2)21-9-7-6-8-10-21;/h6-14,18-19H,15-17H2,1-5H3,(H2,25,26,27);1H |
| InChIKey | FWZKZMNQJABLDT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|