C13H25FN4O — CID 110035895
2-[[(cyclopentylamino)-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110035895) has the molecular formula C13H25FN4O and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclopentylamino)-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110035895 |
| Molecular Formula | C13H25FN4O |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2-[[(cyclopentylamino)-(3-fluoropropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCF)NC1CCCC1 |
| InChI | InChI=1S/C13H25FN4O/c1-18(2)12(19)10-16-13(15-9-5-8-14)17-11-6-3-4-7-11/h11H,3-10H2,1-2H3,(H2,15,16,17) |
| InChIKey | QVULJDNBEMQUDR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|