C19H35F3IN5O2 — CID 110036370
N,N-dimethyl-2-[[(oxolan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110036370) has the molecular formula C19H35F3IN5O2 and a molecular weight of 549.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(oxolan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(oxolan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110036370 |
| Molecular Formula | C19H35F3IN5O2 |
| Molecular Weight | 549.42 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | N,N-dimethyl-2-[[(oxolan-2-ylmethylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(/NCCC1CCN(CC(F)(F)F)CC1)NCC1CCCO1.I |
| InChI | InChI=1S/C19H34F3N5O2.HI/c1-26(2)17(28)13-25-18(24-12-16-4-3-11-29-16)23-8-5-15-6-9-27(10-7-15)14-19(20,21)22;/h15-16H,3-14H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | HJIPNZKFBQJWEB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|