C21H30F2N4O — CID 110036511
2-[[(cyclohexylamino)-[[1-(2,4-difluorophenyl)cyclopropyl]methylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110036511) has the molecular formula C21H30F2N4O and a molecular weight of 392.49 g/mol. Its IUPAC name is 2-[[(cyclohexylamino)-[[1-(2,4-difluorophenyl)cyclopropyl]methylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclohexylamino)-[[1-(2,4-difluorophenyl)cyclopropyl]methylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110036511 |
| Molecular Formula | C21H30F2N4O |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 2-[[(cyclohexylamino)-[[1-(2,4-difluorophenyl)cyclopropyl]methylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1(c2ccc(F)cc2F)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C21H30F2N4O/c1-27(2)19(28)13-24-20(26-16-6-4-3-5-7-16)25-14-21(10-11-21)17-9-8-15(22)12-18(17)23/h8-9,12,16H,3-7,10-11,13-14H2,1-2H3,(H2,24,25,26) |
| InChIKey | VCRMQKREBBMZBG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|