C12H15F8O3P — CID 11003655
(4E)-5-[diethoxyphosphoryl(difluoro)methyl]-6,6,6-trifluoro-4-(trifluoromethyl)hexa-1,4-diene (PubChem CID 11003655) has the molecular formula C12H15F8O3P and a molecular weight of 390.21 g/mol. Its IUPAC name is (4E)-5-[diethoxyphosphoryl(difluoro)methyl]-6,6,6-trifluoro-4-(trifluoromethyl)hexa-1,4-diene.
| Compound Name | (4E)-5-[diethoxyphosphoryl(difluoro)methyl]-6,6,6-trifluoro-4-(trifluoromethyl)hexa-1,4-diene |
|---|---|
| PubChem CID | 11003655 |
| Molecular Formula | C12H15F8O3P |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | (4E)-5-[diethoxyphosphoryl(difluoro)methyl]-6,6,6-trifluoro-4-(trifluoromethyl)hexa-1,4-diene |
| SMILES | C=CC/C(=C(/C(F)(F)F)C(F)(F)P(=O)(OCC)OCC)C(F)(F)F |
| InChI | InChI=1S/C12H15F8O3P/c1-4-7-8(10(13,14)15)9(11(16,17)18)12(19,20)24(21,22-5-2)23-6-3/h4H,1,5-7H2,2-3H3/b9-8+ |
| InChIKey | UGUQBCGNTJPTJX-CMDGGOBGSA-N |
| XLogP | 5.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|