C25H26O2S — CID 11003664
(5E)-5-benzylidene-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-ol (PubChem CID 11003664) has the molecular formula C25H26O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is (5E)-5-benzylidene-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-ol.
| Compound Name | (5E)-5-benzylidene-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-ol |
|---|---|
| PubChem CID | 11003664 |
| Molecular Formula | C25H26O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (5E)-5-benzylidene-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-ol |
| SMILES | COCCCCC#C/C(=C\c1ccccc1)C(O)C#CCSc1ccccc1 |
| InChI | InChI=1S/C25H26O2S/c1-27-19-11-3-2-8-15-23(21-22-13-6-4-7-14-22)25(26)18-12-20-28-24-16-9-5-10-17-24/h4-7,9-10,13-14,16-17,21,25-26H,2-3,11,19-20H2,1H3/b23-21+ |
| InChIKey | FMFAICBTLKQDIK-XTQSDGFTSA-N |
| XLogP | 5.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|