C13H28N4O — CID 110037267
N,N-dimethyl-2-[[(3-methylbutan-2-ylamino)-(propylamino)methylidene]amino]acetamide (PubChem CID 110037267) has the molecular formula C13H28N4O and a molecular weight of 256.39 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(3-methylbutan-2-ylamino)-(propylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(3-methylbutan-2-ylamino)-(propylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110037267 |
| Molecular Formula | C13H28N4O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | N,N-dimethyl-2-[[(3-methylbutan-2-ylamino)-(propylamino)methylidene]amino]acetamide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)NC(C)C(C)C |
| InChI | InChI=1S/C13H28N4O/c1-7-8-14-13(16-11(4)10(2)3)15-9-12(18)17(5)6/h10-11H,7-9H2,1-6H3,(H2,14,15,16) |
| InChIKey | CXZKBTQIIJAHNF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|